C11H14N4S — CID 60913000
3-(1H-benzimidazol-2-ylsulfanyl)butanimidamide (PubChem CID 60913000) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-ylsulfanyl)butanimidamide.
| Compound Name | 3-(1H-benzimidazol-2-ylsulfanyl)butanimidamide |
|---|---|
| PubChem CID | 60913000 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(1H-benzimidazol-2-ylsulfanyl)butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H14N4S/c1-7(6-10(12)13)16-11-14-8-4-2-3-5-9(8)15-11/h2-5,7H,6H2,1H3,(H3,12,13)(H,14,15) |
| InChIKey | YYFIQFHPENLENI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|