C18H18N8O2S2 — CID 173429813
2,3-bis(1H-benzimidazol-2-ylsulfanyl)-1-N',4-N'-dihydroxybutanediimidamide (PubChem CID 173429813) has the molecular formula C18H18N8O2S2 and a molecular weight of 442.53 g/mol. Its IUPAC name is 2,3-bis(1H-benzimidazol-2-ylsulfanyl)-1-N',4-N'-dihydroxybutanediimidamide.
| Compound Name | 2,3-bis(1H-benzimidazol-2-ylsulfanyl)-1-N',4-N'-dihydroxybutanediimidamide |
|---|---|
| PubChem CID | 173429813 |
| Molecular Formula | C18H18N8O2S2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 2,3-bis(1H-benzimidazol-2-ylsulfanyl)-1-N',4-N'-dihydroxybutanediimidamide |
| SMILES | NC(=NO)C(Sc1nc2ccccc2[nH]1)C(Sc1nc2ccccc2[nH]1)C(N)=NO |
| InChI | InChI=1S/C18H18N8O2S2/c19-15(25-27)13(29-17-21-9-5-1-2-6-10(9)22-17)14(16(20)26-28)30-18-23-11-7-3-4-8-12(11)24-18/h1-8,13-14,27-28H,(H2,19,25)(H2,20,26)(H,21,22)(H,23,24) |
| InChIKey | XKTBTLJMZYPLQJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 174.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|