C8H7N4Se — CID 175276367
CID 175276367 (PubChem CID 175276367) has the molecular formula C8H7N4Se and a molecular weight of 238.13 g/mol.
| Compound Name | CID 175276367 |
|---|---|
| PubChem CID | 175276367 |
| Molecular Formula | C8H7N4Se |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | — |
| SMILES | NC([Se])=Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H7N4Se/c9-7(13)12-8-10-5-3-1-2-4-6(5)11-8/h1-4H,(H3,9,10,11,12) |
| InChIKey | CNYZTYDWXGMFEC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|