About (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide
(2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide (PubChem CID 135723236) has the molecular formula C11H6N6
and a molecular weight of 222.21 g/mol. Its IUPAC name is (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide.
Molecular Properties
| Compound Name | (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide |
| PubChem CID | 135723236 |
| Molecular Formula | C11H6N6 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide |
| SMILES | [H]/N=C(C#N)/C(C#N)=N/c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H6N6/c12-5-7(14)10(6-13)17-11-15-8-3-1-2-4-9(8)16-11/h1-4,14H,(H,15,16)/b14-7+,17-10+ |
| InChIKey | BFXBIYZCMOHRII-INXVSMFASA-N |
| XLogP | 1.70 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide?
The IUPAC name of (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide (CID 135723236) is (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide.
What is the SMILES notation for (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide?
The canonical SMILES for (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide is [H]/N=C(C#N)/C(C#N)=N/c1nc2ccccc2[nH]1.
What is the InChIKey of (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide?
The InChIKey is BFXBIYZCMOHRII-INXVSMFASA-N. The full InChI is InChI=1S/C11H6N6/c12-5-7(14)10(6-13)17-11-15-8-3-1-2-4-9(8)16-11/h1-4,14H,(H,15,16)/b14-7+,17-10+.
What are the key properties of (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide?
(2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide has a molecular weight of 222.21 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N'-(1H-benzimidazol-2-yl)ethanediimidoyl dicyanide is sourced from PubChem (CID 135723236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).