C25H36N6O3 — CID 44724425
7-decyl-8-[(2E)-2-[1-(4-methoxyphenyl)ethylidene]hydrazinyl]-3-methylpurine-2,6-dione (PubChem CID 44724425) has the molecular formula C25H36N6O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 7-decyl-8-[(2E)-2-[1-(4-methoxyphenyl)ethylidene]hydrazinyl]-3-methylpurine-2,6-dione.
| Compound Name | 7-decyl-8-[(2E)-2-[1-(4-methoxyphenyl)ethylidene]hydrazinyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 44724425 |
| Molecular Formula | C25H36N6O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 7-decyl-8-[(2E)-2-[1-(4-methoxyphenyl)ethylidene]hydrazinyl]-3-methylpurine-2,6-dione |
| SMILES | CCCCCCCCCCn1c(N/N=C(\C)c2ccc(OC)cc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C25H36N6O3/c1-5-6-7-8-9-10-11-12-17-31-21-22(30(3)25(33)27-23(21)32)26-24(31)29-28-18(2)19-13-15-20(34-4)16-14-19/h13-16H,5-12,17H2,1-4H3,(H,26,29)(H,27,32,33)/b28-18+ |
| InChIKey | QCJCEVYOQBCZSO-MTDXEUNCSA-N |
| XLogP | 4.41 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|