C21H28N6O3 — CID 6293536
8-[(2Z)-2-hexan-2-ylidenehydrazinyl]-7-[2-(4-methoxyphenyl)ethyl]-3-methylpurine-2,6-dione (PubChem CID 6293536) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 8-[(2Z)-2-hexan-2-ylidenehydrazinyl]-7-[2-(4-methoxyphenyl)ethyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2Z)-2-hexan-2-ylidenehydrazinyl]-7-[2-(4-methoxyphenyl)ethyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 6293536 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 8-[(2Z)-2-hexan-2-ylidenehydrazinyl]-7-[2-(4-methoxyphenyl)ethyl]-3-methylpurine-2,6-dione |
| SMILES | CCCC/C(C)=N\Nc1nc2c(c(=O)[nH]c(=O)n2C)n1CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28N6O3/c1-5-6-7-14(2)24-25-20-22-18-17(19(28)23-21(29)26(18)3)27(20)13-12-15-8-10-16(30-4)11-9-15/h8-11H,5-7,12-13H2,1-4H3,(H,22,25)(H,23,28,29)/b24-14- |
| InChIKey | DMUPJIJPFLDKNE-OYKKKHCWSA-N |
| XLogP | 2.65 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|