C19H29N5O2 — CID 7006425
3-methyl-7-(2-methylprop-2-enyl)-8-[[(1S,5R)-3,3,5-trimethylcyclohexyl]amino]purine-2,6-dione (PubChem CID 7006425) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-methyl-7-(2-methylprop-2-enyl)-8-[[(1S,5R)-3,3,5-trimethylcyclohexyl]amino]purine-2,6-dione.
| Compound Name | 3-methyl-7-(2-methylprop-2-enyl)-8-[[(1S,5R)-3,3,5-trimethylcyclohexyl]amino]purine-2,6-dione |
|---|---|
| PubChem CID | 7006425 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 3-methyl-7-(2-methylprop-2-enyl)-8-[[(1S,5R)-3,3,5-trimethylcyclohexyl]amino]purine-2,6-dione |
| SMILES | C=C(C)Cn1c(N[C@H]2C[C@H](C)CC(C)(C)C2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C19H29N5O2/c1-11(2)10-24-14-15(23(6)18(26)22-16(14)25)21-17(24)20-13-7-12(3)8-19(4,5)9-13/h12-13H,1,7-10H2,2-6H3,(H,20,21)(H,22,25,26)/t12-,13-/m0/s1 |
| InChIKey | YITVTZWVMKQFDS-STQMWFEESA-N |
| XLogP | 2.63 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|