C14H14N4O2S — CID 677667
3-methyl-7-[(4-methylphenyl)methyl]-8-sulfanylidene-9H-purine-2,6-dione (PubChem CID 677667) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-methyl-7-[(4-methylphenyl)methyl]-8-sulfanylidene-9H-purine-2,6-dione.
| Compound Name | 3-methyl-7-[(4-methylphenyl)methyl]-8-sulfanylidene-9H-purine-2,6-dione |
|---|---|
| PubChem CID | 677667 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-methyl-7-[(4-methylphenyl)methyl]-8-sulfanylidene-9H-purine-2,6-dione |
| SMILES | Cc1ccc(Cn2c(=S)[nH]c3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C14H14N4O2S/c1-8-3-5-9(6-4-8)7-18-10-11(15-14(18)21)17(2)13(20)16-12(10)19/h3-6H,7H2,1-2H3,(H,15,21)(H,16,19,20) |
| InChIKey | UBCDJOXBMSRYRD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|