About 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione
3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione (PubChem CID 10282141) has the molecular formula C27H31IN6O2
and a molecular weight of 598.49 g/mol. Its IUPAC name is 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione.
Molecular Properties
| Compound Name | 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione |
| PubChem CID | 10282141 |
| Molecular Formula | C27H31IN6O2 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(N3CCCNCC3)n2Cc2ccccc2I)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C27H31IN6O2/c1-2-15-32-25(35)23-24(34(27(32)36)18-20-9-4-3-5-10-20)30-26(31-16-8-13-29-14-17-31)33(23)19-21-11-6-7-12-22(21)28/h3-7,9-12,29H,2,8,13-19H2,1H3 |
| InChIKey | IKXOFFFGTPLULJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione?
The IUPAC name of 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione (CID 10282141) is 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione.
What is the SMILES notation for 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione?
The canonical SMILES for 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione is CCCn1c(=O)c2c(nc(N3CCCNCC3)n2Cc2ccccc2I)n(Cc2ccccc2)c1=O.
What is the InChIKey of 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione?
The InChIKey is IKXOFFFGTPLULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31IN6O2/c1-2-15-32-25(35)23-24(34(27(32)36)18-20-9-4-3-5-10-20)30-26(31-16-8-13-29-14-17-31)33(23)19-21-11-6-7-12-22(21)28/h3-7,9-12,29H,2,8,13-19H2,1H3.
What are the key properties of 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione?
3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione has a molecular weight of 598.49 g/mol, XLogP of 3.27, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione is sourced from PubChem (CID 10282141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).