C27H31IN6O2 — CID 10282141
3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione (PubChem CID 10282141) has the molecular formula C27H31IN6O2 and a molecular weight of 598.49 g/mol. Its IUPAC name is 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione.
| Compound Name | 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 10282141 |
| Molecular Formula | C27H31IN6O2 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(N3CCCNCC3)n2Cc2ccccc2I)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C27H31IN6O2/c1-2-15-32-25(35)23-24(34(27(32)36)18-20-9-4-3-5-10-20)30-26(31-16-8-13-29-14-17-31)33(23)19-21-11-6-7-12-22(21)28/h3-7,9-12,29H,2,8,13-19H2,1H3 |
| InChIKey | IKXOFFFGTPLULJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|