C21H23F3N6O3 — CID 142670926
(7-benzyl-6-oxo-8-piperazin-1-yl-1-propylpurin-2-yl) 2,2,2-trifluoroacetate (PubChem CID 142670926) has the molecular formula C21H23F3N6O3 and a molecular weight of 464.45 g/mol. Its IUPAC name is (7-benzyl-6-oxo-8-piperazin-1-yl-1-propylpurin-2-yl) 2,2,2-trifluoroacetate.
| Compound Name | (7-benzyl-6-oxo-8-piperazin-1-yl-1-propylpurin-2-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142670926 |
| Molecular Formula | C21H23F3N6O3 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (7-benzyl-6-oxo-8-piperazin-1-yl-1-propylpurin-2-yl) 2,2,2-trifluoroacetate |
| SMILES | CCCn1c(OC(=O)C(F)(F)F)nc2nc(N3CCNCC3)n(Cc3ccccc3)c2c1=O |
| InChI | InChI=1S/C21H23F3N6O3/c1-2-10-29-17(31)15-16(27-20(29)33-18(32)21(22,23)24)26-19(28-11-8-25-9-12-28)30(15)13-14-6-4-3-5-7-14/h3-7,25H,2,8-13H2,1H3 |
| InChIKey | RPALAZMMDQCCMY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |