C18H19N7O — CID 23070780
2-(7-benzyl-6-oxo-8-piperazin-1-ylpurin-1-yl)acetonitrile (PubChem CID 23070780) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is 2-(7-benzyl-6-oxo-8-piperazin-1-ylpurin-1-yl)acetonitrile.
| Compound Name | 2-(7-benzyl-6-oxo-8-piperazin-1-ylpurin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 23070780 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-(7-benzyl-6-oxo-8-piperazin-1-ylpurin-1-yl)acetonitrile |
| SMILES | N#CCn1cnc2nc(N3CCNCC3)n(Cc3ccccc3)c2c1=O |
| InChI | InChI=1S/C18H19N7O/c19-6-9-24-13-21-16-15(17(24)26)25(12-14-4-2-1-3-5-14)18(22-16)23-10-7-20-8-11-23/h1-5,13,20H,7-12H2 |
| InChIKey | GRLWCHGMPBDUKL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |