C20H22N6O2 — CID 89356853
8-(1,4-diazepan-1-yl)-7-[(2-ethynylphenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 89356853) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 8-(1,4-diazepan-1-yl)-7-[(2-ethynylphenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(1,4-diazepan-1-yl)-7-[(2-ethynylphenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 89356853 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 8-(1,4-diazepan-1-yl)-7-[(2-ethynylphenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | C#Cc1ccccc1Cn1c(N2CCCNCC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C20H22N6O2/c1-3-14-7-4-5-8-15(14)13-26-16-17(24(2)20(28)23-18(16)27)22-19(26)25-11-6-9-21-10-12-25/h1,4-5,7-8,21H,6,9-13H2,2H3,(H,23,27,28) |
| InChIKey | UIIWWKWCUFWEBL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|