C27H31F3N6O4 — CID 66953396
[(1S)-2-[8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]-1-phenylethyl] 2,2,2-trifluoroacetate (PubChem CID 66953396) has the molecular formula C27H31F3N6O4 and a molecular weight of 560.58 g/mol. Its IUPAC name is [(1S)-2-[8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]-1-phenylethyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S)-2-[8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]-1-phenylethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66953396 |
| Molecular Formula | C27H31F3N6O4 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | [(1S)-2-[8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]-1-phenylethyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)=CCn1c(N2CCC3CNCC32)nc2c1c(=O)n(C[C@@H](OC(=O)C(F)(F)F)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C27H31F3N6O4/c1-16(2)9-11-35-21-22(32-25(35)34-12-10-18-13-31-14-19(18)34)33(3)26(39)36(23(21)37)15-20(17-7-5-4-6-8-17)40-24(38)27(28,29)30/h4-9,18-20,31H,10-15H2,1-3H3/t18?,19?,20-/m1/s1 |
| InChIKey | NTMMKTGPAMYDLR-SOAGJPPSSA-N |
| XLogP | 2.51 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|