C20H28N10O2 — CID 66953717
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[1-(2H-tetrazol-5-yl)ethyl]purine-2,6-dione (PubChem CID 66953717) has the molecular formula C20H28N10O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[1-(2H-tetrazol-5-yl)ethyl]purine-2,6-dione.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[1-(2H-tetrazol-5-yl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 66953717 |
| Molecular Formula | C20H28N10O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[1-(2H-tetrazol-5-yl)ethyl]purine-2,6-dione |
| SMILES | CC(C)=CCn1c(N2CCC3CNCC32)nc2c1c(=O)n(C(C)c1nn[nH]n1)c(=O)n2C |
| InChI | InChI=1S/C20H28N10O2/c1-11(2)5-7-29-15-17(22-19(29)28-8-6-13-9-21-10-14(13)28)27(4)20(32)30(18(15)31)12(3)16-23-25-26-24-16/h5,12-14,21H,6-10H2,1-4H3,(H,23,24,25,26) |
| InChIKey | CUTROYRWOHBMTC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|