C19H28N6O2 — CID 68688839
8-[(3aR,6aR)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl]-1-ethyl-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione (PubChem CID 68688839) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 8-[(3aR,6aR)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl]-1-ethyl-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione.
| Compound Name | 8-[(3aR,6aR)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl]-1-ethyl-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione |
|---|---|
| PubChem CID | 68688839 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 8-[(3aR,6aR)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl]-1-ethyl-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(N3CC[C@H]4NCC[C@H]43)n2CC=C(C)C)n(C)c1=O |
| InChI | InChI=1S/C19H28N6O2/c1-5-23-17(26)15-16(22(4)19(23)27)21-18(25(15)10-7-12(2)3)24-11-8-13-14(24)6-9-20-13/h7,13-14,20H,5-6,8-11H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | UHXLSPPVAKIJHF-ZIAGYGMSSA-N |
| XLogP | 0.82 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|