C25H29ClFN7O2S — CID 66953606
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione;hydrochloride (PubChem CID 66953606) has the molecular formula C25H29ClFN7O2S and a molecular weight of 546.07 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione;hydrochloride.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 66953606 |
| Molecular Formula | C25H29ClFN7O2S |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione;hydrochloride |
| SMILES | CC(C)=CCn1c(N2CCC3CNCC32)nc2c1c(=O)n(Cc1nc3cc(F)ccc3s1)c(=O)n2C.Cl |
| InChI | InChI=1S/C25H28FN7O2S.ClH/c1-14(2)6-8-32-21-22(29-24(32)31-9-7-15-11-27-12-18(15)31)30(3)25(35)33(23(21)34)13-20-28-17-10-16(26)4-5-19(17)36-20;/h4-6,10,15,18,27H,7-9,11-13H2,1-3H3;1H |
| InChIKey | CDFSSQPQXDXCHB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|