C24H29F3N6O3 — CID 87213682
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-3-methyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione (PubChem CID 87213682) has the molecular formula C24H29F3N6O3 and a molecular weight of 506.53 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-3-methyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-3-methyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 87213682 |
| Molecular Formula | C24H29F3N6O3 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-3-methyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione |
| SMILES | CCOCCn1c(=O)c2c(nc(N3CCC4CNCC43)n2Cc2cccc(C(F)(F)F)c2)n(C)c1=O |
| InChI | InChI=1S/C24H29F3N6O3/c1-3-36-10-9-32-21(34)19-20(30(2)23(32)35)29-22(31-8-7-16-12-28-13-18(16)31)33(19)14-15-5-4-6-17(11-15)24(25,26)27/h4-6,11,16,18,28H,3,7-10,12-14H2,1-2H3 |
| InChIKey | IUTYQGUIWGDLLJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|