C31H37FN6O3 — CID 66954324
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-[2-(1-adamantyl)-2-oxoethyl]-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 66954324) has the molecular formula C31H37FN6O3 and a molecular weight of 560.67 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-[2-(1-adamantyl)-2-oxoethyl]-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-[2-(1-adamantyl)-2-oxoethyl]-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66954324 |
| Molecular Formula | C31H37FN6O3 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-[2-(1-adamantyl)-2-oxoethyl]-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(CC(=O)C23CC4CC(CC(C4)C2)C3)c(=O)c2c1nc(N1CCC3CNCC31)n2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C31H37FN6O3/c1-35-27-26(28(40)38(30(35)41)17-25(39)31-11-19-8-20(12-31)10-21(9-19)13-31)37(16-18-2-4-23(32)5-3-18)29(34-27)36-7-6-22-14-33-15-24(22)36/h2-5,19-22,24,33H,6-17H2,1H3 |
| InChIKey | JBJIBKNARMYAIP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |