C26H33FN6O2 — CID 66954015
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-7-(cyclohexylmethyl)-1-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 66954015) has the molecular formula C26H33FN6O2 and a molecular weight of 480.59 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-7-(cyclohexylmethyl)-1-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-7-(cyclohexylmethyl)-1-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66954015 |
| Molecular Formula | C26H33FN6O2 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-7-(cyclohexylmethyl)-1-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2ccc(F)cc2)c(=O)c2c1nc(N1CCC3CNCC31)n2CC1CCCCC1 |
| InChI | InChI=1S/C26H33FN6O2/c1-30-23-22(24(34)33(26(30)35)16-18-7-9-20(27)10-8-18)32(15-17-5-3-2-4-6-17)25(29-23)31-12-11-19-13-28-14-21(19)31/h7-10,17,19,21,28H,2-6,11-16H2,1H3 |
| InChIKey | TZVUFCLARYSMEA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |