C23H29FN6O3 — CID 66954845
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 66954845) has the molecular formula C23H29FN6O3 and a molecular weight of 456.52 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66954845 |
| Molecular Formula | C23H29FN6O3 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | CCOCCn1c(=O)c2c(nc(N3CCC4CNCC43)n2Cc2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C23H29FN6O3/c1-3-33-11-10-29-21(31)19-20(27(2)23(29)32)26-22(28-9-8-16-12-25-13-18(16)28)30(19)14-15-4-6-17(24)7-5-15/h4-7,16,18,25H,3,8-14H2,1-2H3 |
| InChIKey | GIWJBRMEUUVOLH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|