C25H30F4N6O5 — CID 66954844
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 66954844) has the molecular formula C25H30F4N6O5 and a molecular weight of 570.54 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66954844 |
| Molecular Formula | C25H30F4N6O5 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1-(2-ethoxyethyl)-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CCOCCn1c(=O)c2c(nc(N3CCC4CNCC43)n2Cc2ccc(F)cc2)n(C)c1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H29FN6O3.C2HF3O2/c1-3-33-11-10-29-21(31)19-20(27(2)23(29)32)26-22(28-9-8-16-12-25-13-18(16)28)30(19)14-15-4-6-17(24)7-5-15;3-2(4,5)1(6)7/h4-7,16,18,25H,3,8-14H2,1-2H3;(H,6,7) |
| InChIKey | YOUOVYBTEOFQKT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|