C19H30N7O2+ — CID 3709446
7-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylamino)propyl]-1,3-dimethyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 3709446) has the molecular formula C19H30N7O2+ and a molecular weight of 388.50 g/mol. Its IUPAC name is 7-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylamino)propyl]-1,3-dimethyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 7-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylamino)propyl]-1,3-dimethyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 3709446 |
| Molecular Formula | C19H30N7O2+ |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 7-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylamino)propyl]-1,3-dimethyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCCCC3)n2CCCNC2=[NH+]CCC2)n(C)c1=O |
| InChI | InChI=1S/C19H29N7O2/c1-23-16-15(17(27)24(2)19(23)28)26(13-7-10-21-14-8-6-9-20-14)18(22-16)25-11-4-3-5-12-25/h3-13H2,1-2H3,(H,20,21)/p+1 |
| InChIKey | UAQZMKREEXXLDU-UHFFFAOYSA-O |
| XLogP | -1.32 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|