C19H30N7O3+ — CID 4609015
1,3-dimethyl-7-[2-(morpholin-4-ium-4-ylidenemethylamino)ethyl]-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 4609015) has the molecular formula C19H30N7O3+ and a molecular weight of 404.50 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-(morpholin-4-ium-4-ylidenemethylamino)ethyl]-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-(morpholin-4-ium-4-ylidenemethylamino)ethyl]-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 4609015 |
| Molecular Formula | C19H30N7O3+ |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 1,3-dimethyl-7-[2-(morpholin-4-ium-4-ylidenemethylamino)ethyl]-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCCCC3)n2CCNC=[N+]2CCOCC2)n(C)c1=O |
| InChI | InChI=1S/C19H29N7O3/c1-22-16-15(17(27)23(2)19(22)28)26(18(21-16)25-7-4-3-5-8-25)9-6-20-14-24-10-12-29-13-11-24/h14H,3-13H2,1-2H3/p+1 |
| InChIKey | DGCRTKVDBFCENY-UHFFFAOYSA-O |
| XLogP | -0.92 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|