C18H20N4O4S — CID 651627
benzyl 2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate (PubChem CID 651627) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is benzyl 2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate.
| Compound Name | benzyl 2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate |
|---|---|
| PubChem CID | 651627 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | benzyl 2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate |
| SMILES | CCn1c(SCC(=O)OCc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C18H20N4O4S/c1-4-22-14-15(20(2)18(25)21(3)16(14)24)19-17(22)27-11-13(23)26-10-12-8-6-5-7-9-12/h5-9H,4,10-11H2,1-3H3 |
| InChIKey | ODUOPFLDAXVKGN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |