C17H16N4O4 — CID 3594138
2-(1,3-dimethyl-2,6-dioxo-7-prop-2-enylpurin-8-yl)oxybenzaldehyde (PubChem CID 3594138) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-7-prop-2-enylpurin-8-yl)oxybenzaldehyde.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-7-prop-2-enylpurin-8-yl)oxybenzaldehyde |
|---|---|
| PubChem CID | 3594138 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-7-prop-2-enylpurin-8-yl)oxybenzaldehyde |
| SMILES | C=CCn1c(Oc2ccccc2C=O)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H16N4O4/c1-4-9-21-13-14(19(2)17(24)20(3)15(13)23)18-16(21)25-12-8-6-5-7-11(12)10-22/h4-8,10H,1,9H2,2-3H3 |
| InChIKey | JMIBPGJNWGHBNV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|