C16H16N4O4 — CID 162654602
4-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)oxybenzaldehyde (PubChem CID 162654602) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 4-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)oxybenzaldehyde.
| Compound Name | 4-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)oxybenzaldehyde |
|---|---|
| PubChem CID | 162654602 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)oxybenzaldehyde |
| SMILES | CCn1c(Oc2ccc(C=O)cc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H16N4O4/c1-4-20-12-13(18(2)16(23)19(3)14(12)22)17-15(20)24-11-7-5-10(9-21)6-8-11/h5-9H,4H2,1-3H3 |
| InChIKey | AHPIIXKBHUCZJM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|