C22H30N4O3 — CID 3389763
7-(3-ethylheptyl)-1,3-dimethyl-8-phenoxypurine-2,6-dione (PubChem CID 3389763) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 7-(3-ethylheptyl)-1,3-dimethyl-8-phenoxypurine-2,6-dione.
| Compound Name | 7-(3-ethylheptyl)-1,3-dimethyl-8-phenoxypurine-2,6-dione |
|---|---|
| PubChem CID | 3389763 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 7-(3-ethylheptyl)-1,3-dimethyl-8-phenoxypurine-2,6-dione |
| SMILES | CCCCC(CC)CCn1c(Oc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C22H30N4O3/c1-5-7-11-16(6-2)14-15-26-18-19(24(3)22(28)25(4)20(18)27)23-21(26)29-17-12-9-8-10-13-17/h8-10,12-13,16H,5-7,11,14-15H2,1-4H3 |
| InChIKey | WPHMCQWAWFSFMP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |