C23H30N4O5 — CID 4236224
methyl 4-(1,3-dimethyl-7-octyl-2,6-dioxopurin-8-yl)oxybenzoate (PubChem CID 4236224) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is methyl 4-(1,3-dimethyl-7-octyl-2,6-dioxopurin-8-yl)oxybenzoate.
| Compound Name | methyl 4-(1,3-dimethyl-7-octyl-2,6-dioxopurin-8-yl)oxybenzoate |
|---|---|
| PubChem CID | 4236224 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | methyl 4-(1,3-dimethyl-7-octyl-2,6-dioxopurin-8-yl)oxybenzoate |
| SMILES | CCCCCCCCn1c(Oc2ccc(C(=O)OC)cc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H30N4O5/c1-5-6-7-8-9-10-15-27-18-19(25(2)23(30)26(3)20(18)28)24-22(27)32-17-13-11-16(12-14-17)21(29)31-4/h11-14H,5-10,15H2,1-4H3 |
| InChIKey | AWZCGDAXCQMINQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|