C11H21N3O3 — CID 159762511
1-ethyl-3-methyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione;methane (PubChem CID 159762511) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-ethyl-3-methyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione;methane.
| Compound Name | 1-ethyl-3-methyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione;methane |
|---|---|
| PubChem CID | 159762511 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1-ethyl-3-methyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione;methane |
| SMILES | C.C.C=CCn1c(=O)n(C)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C9H13N3O3.2CH4/c1-4-6-12-8(14)10(3)7(13)11(5-2)9(12)15;;/h4H,1,5-6H2,2-3H3;2*1H4 |
| InChIKey | NFBNQUYOCAKHPE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|