C22H28N6O7 — CID 157315329
1-methyl-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione;1-(oxiran-2-ylmethyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 157315329) has the molecular formula C22H28N6O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is 1-methyl-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione;1-(oxiran-2-ylmethyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-methyl-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione;1-(oxiran-2-ylmethyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 157315329 |
| Molecular Formula | C22H28N6O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 1-methyl-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione;1-(oxiran-2-ylmethyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(C)c(=O)n(CC=C)c1=O.C=CCn1c(=O)n(CC=C)c(=O)n(CC2CO2)c1=O |
| InChI | InChI=1S/C12H15N3O4.C10H13N3O3/c1-3-5-13-10(16)14(6-4-2)12(18)15(11(13)17)7-9-8-19-9;1-4-6-12-8(14)11(3)9(15)13(7-5-2)10(12)16/h3-4,9H,1-2,5-8H2;4-5H,1-2,6-7H2,3H3 |
| InChIKey | BDNHYGRHZGYWPQ-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 144.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|