C12H15N3O4 — CID 88695122
1-(oxiran-2-ylmethyl)-3,5-bis[(Z)-prop-1-enyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 88695122) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-(oxiran-2-ylmethyl)-3,5-bis[(Z)-prop-1-enyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(oxiran-2-ylmethyl)-3,5-bis[(Z)-prop-1-enyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 88695122 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-(oxiran-2-ylmethyl)-3,5-bis[(Z)-prop-1-enyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C/C=C\n1c(=O)n(/C=C\C)c(=O)n(CC2CO2)c1=O |
| InChI | InChI=1S/C12H15N3O4/c1-3-5-13-10(16)14(6-4-2)12(18)15(11(13)17)7-9-8-19-9/h3-6,9H,7-8H2,1-2H3/b5-3-,6-4- |
| InChIKey | PAVBUIHRWGNSEF-GLIMQPGKSA-N |
| XLogP | -0.45 |
| TPSA | 78.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|