C10H13N3O4 — CID 88695518
1-methyl-3-(oxiran-2-ylmethyl)-5-[(Z)-prop-1-enyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 88695518) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 1-methyl-3-(oxiran-2-ylmethyl)-5-[(Z)-prop-1-enyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-methyl-3-(oxiran-2-ylmethyl)-5-[(Z)-prop-1-enyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 88695518 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-methyl-3-(oxiran-2-ylmethyl)-5-[(Z)-prop-1-enyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C/C=C\n1c(=O)n(C)c(=O)n(CC2CO2)c1=O |
| InChI | InChI=1S/C10H13N3O4/c1-3-4-12-8(14)11(2)9(15)13(10(12)16)5-7-6-17-7/h3-4,7H,5-6H2,1-2H3/b4-3- |
| InChIKey | VZYGUQDGVBBANP-ARJAWSKDSA-N |
| XLogP | -1.40 |
| TPSA | 78.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|