C16H23N3O6 — CID 171460051
1-(oxiran-2-ylmethyl)-3,5-bis[3-(oxiran-2-yl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 171460051) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-(oxiran-2-ylmethyl)-3,5-bis[3-(oxiran-2-yl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(oxiran-2-ylmethyl)-3,5-bis[3-(oxiran-2-yl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 171460051 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-(oxiran-2-ylmethyl)-3,5-bis[3-(oxiran-2-yl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CCCC2CO2)c(=O)n(CC2CO2)c(=O)n1CCCC1CO1 |
| InChI | InChI=1S/C16H23N3O6/c20-14-17(5-1-3-11-8-23-11)15(21)19(7-13-10-25-13)16(22)18(14)6-2-4-12-9-24-12/h11-13H,1-10H2 |
| InChIKey | OGXNIOQGXGGQEU-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 103.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|