C25H45N3O3Si — CID 153322078
1,3-bis(prop-2-enyl)-5-(tripentylsilylmethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 153322078) has the molecular formula C25H45N3O3Si and a molecular weight of 463.74 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-5-(tripentylsilylmethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(prop-2-enyl)-5-(tripentylsilylmethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 153322078 |
| Molecular Formula | C25H45N3O3Si |
| Molecular Weight | 463.74 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-5-(tripentylsilylmethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(C[Si](CCCCC)(CCCCC)CCCCC)c1=O |
| InChI | InChI=1S/C25H45N3O3Si/c1-6-11-14-19-32(20-15-12-7-2,21-16-13-8-3)22-28-24(30)26(17-9-4)23(29)27(18-10-5)25(28)31/h9-10H,4-8,11-22H2,1-3H3 |
| InChIKey | SMXOYXSGDSWLLB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|