C16H24N4O4 — CID 78815070
N-pentyl-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 78815070) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-pentyl-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-pentyl-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 78815070 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-pentyl-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NCCCCC)c1=O |
| InChI | InChI=1S/C16H24N4O4/c1-4-7-8-9-17-13(21)12-20-15(23)18(10-5-2)14(22)19(11-6-3)16(20)24/h5-6H,2-4,7-12H2,1H3,(H,17,21) |
| InChIKey | ZIRDDILXTKBNRE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|