C18H27N3O3S — CID 141463438
N-butyl-2-(7-methyl-2,4-dioxo-1-pentylthieno[3,2-d]pyrimidin-3-yl)acetamide (PubChem CID 141463438) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-butyl-2-(7-methyl-2,4-dioxo-1-pentylthieno[3,2-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-butyl-2-(7-methyl-2,4-dioxo-1-pentylthieno[3,2-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 141463438 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-butyl-2-(7-methyl-2,4-dioxo-1-pentylthieno[3,2-d]pyrimidin-3-yl)acetamide |
| SMILES | CCCCCn1c(=O)n(CC(=O)NCCCC)c(=O)c2scc(C)c21 |
| InChI | InChI=1S/C18H27N3O3S/c1-4-6-8-10-20-15-13(3)12-25-16(15)17(23)21(18(20)24)11-14(22)19-9-7-5-2/h12H,4-11H2,1-3H3,(H,19,22) |
| InChIKey | KSWDBFLGTXPTKQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|