C19H29N3O3S — CID 141463465
N-tert-butyl-2-(5,6-dimethyl-2,4-dioxo-1-pentylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 141463465) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-tert-butyl-2-(5,6-dimethyl-2,4-dioxo-1-pentylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-tert-butyl-2-(5,6-dimethyl-2,4-dioxo-1-pentylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 141463465 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-tert-butyl-2-(5,6-dimethyl-2,4-dioxo-1-pentylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | CCCCCn1c(=O)n(CC(=O)NC(C)(C)C)c(=O)c2c(C)c(C)sc21 |
| InChI | InChI=1S/C19H29N3O3S/c1-7-8-9-10-21-17-15(12(2)13(3)26-17)16(24)22(18(21)25)11-14(23)20-19(4,5)6/h7-11H2,1-6H3,(H,20,23) |
| InChIKey | MBNZIKOJNMOKPG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|