C28H27N3O3Si — CID 153322113
1,3-bis(prop-2-enyl)-5-(triphenylsilylmethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 153322113) has the molecular formula C28H27N3O3Si and a molecular weight of 481.63 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-5-(triphenylsilylmethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(prop-2-enyl)-5-(triphenylsilylmethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 153322113 |
| Molecular Formula | C28H27N3O3Si |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-5-(triphenylsilylmethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(C[Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C28H27N3O3Si/c1-3-20-29-26(32)30(21-4-2)28(34)31(27(29)33)22-35(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h3-19H,1-2,20-22H2 |
| InChIKey | VMHMCAIPOQRGDV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|