C30H31N3O4Si — CID 153322046
1,3-bis(prop-2-enyl)-5-(1-triphenylsilylethoxymethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 153322046) has the molecular formula C30H31N3O4Si and a molecular weight of 525.68 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-5-(1-triphenylsilylethoxymethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(prop-2-enyl)-5-(1-triphenylsilylethoxymethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 153322046 |
| Molecular Formula | C30H31N3O4Si |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-5-(1-triphenylsilylethoxymethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(COC(C)[Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C30H31N3O4Si/c1-4-21-31-28(34)32(22-5-2)30(36)33(29(31)35)23-37-24(3)38(25-15-9-6-10-16-25,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h4-20,24H,1-2,21-23H2,3H3 |
| InChIKey | AXACWTYNAFSWAR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|