C31H40N3O3P — CID 15848110
1-(10-diphenylphosphanyldecyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 15848110) has the molecular formula C31H40N3O3P and a molecular weight of 533.65 g/mol. Its IUPAC name is 1-(10-diphenylphosphanyldecyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(10-diphenylphosphanyldecyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15848110 |
| Molecular Formula | C31H40N3O3P |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 1-(10-diphenylphosphanyldecyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCCCCCCCCCP(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C31H40N3O3P/c1-3-23-32-29(35)33(24-4-2)31(37)34(30(32)36)25-17-9-7-5-6-8-10-18-26-38(27-19-13-11-14-20-27)28-21-15-12-16-22-28/h3-4,11-16,19-22H,1-2,5-10,17-18,23-26H2 |
| InChIKey | RFZUIKFTFLCPBJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|