C26H30N3O3P — CID 15848108
1-(5-diphenylphosphanylpentyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 15848108) has the molecular formula C26H30N3O3P and a molecular weight of 463.52 g/mol. Its IUPAC name is 1-(5-diphenylphosphanylpentyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(5-diphenylphosphanylpentyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15848108 |
| Molecular Formula | C26H30N3O3P |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 1-(5-diphenylphosphanylpentyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCCCCP(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C26H30N3O3P/c1-3-18-27-24(30)28(19-4-2)26(32)29(25(27)31)20-12-7-13-21-33(22-14-8-5-9-15-22)23-16-10-6-11-17-23/h3-6,8-11,14-17H,1-2,7,12-13,18-21H2 |
| InChIKey | GIZPBFIWMSOTLQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|