C26H29N6O7P — CID 3839026
1-[[phenyl-[[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]methyl]phosphoryl]methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 3839026) has the molecular formula C26H29N6O7P and a molecular weight of 568.53 g/mol. Its IUPAC name is 1-[[phenyl-[[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]methyl]phosphoryl]methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[[phenyl-[[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]methyl]phosphoryl]methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3839026 |
| Molecular Formula | C26H29N6O7P |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 1-[[phenyl-[[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]methyl]phosphoryl]methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CP(=O)(Cn2c(=O)n(CC=C)c(=O)n(CC=C)c2=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C26H29N6O7P/c1-5-14-27-21(33)28(15-6-2)24(36)31(23(27)35)18-40(39,20-12-10-9-11-13-20)19-32-25(37)29(16-7-3)22(34)30(17-8-4)26(32)38/h5-13H,1-4,14-19H2 |
| InChIKey | ZUXZSHTXPOWHJA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 149.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|