C14H20N3O2P — CID 101046524
1,3,5-triethyl-2-phenyl-1,3,5,2-triazaphosphinane-4,6-dione (PubChem CID 101046524) has the molecular formula C14H20N3O2P and a molecular weight of 293.31 g/mol. Its IUPAC name is 1,3,5-triethyl-2-phenyl-1,3,5,2-triazaphosphinane-4,6-dione.
| Compound Name | 1,3,5-triethyl-2-phenyl-1,3,5,2-triazaphosphinane-4,6-dione |
|---|---|
| PubChem CID | 101046524 |
| Molecular Formula | C14H20N3O2P |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 1,3,5-triethyl-2-phenyl-1,3,5,2-triazaphosphinane-4,6-dione |
| SMILES | CCN1C(=O)N(CC)P(c2ccccc2)N(CC)C1=O |
| InChI | InChI=1S/C14H20N3O2P/c1-4-15-13(18)16(5-2)20(17(6-3)14(15)19)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChIKey | ITBHICBVOKPWKS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|