C17H19ClN3O4P — CID 3892982
1-[[chloromethyl(phenyl)phosphoryl]methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 3892982) has the molecular formula C17H19ClN3O4P and a molecular weight of 395.78 g/mol. Its IUPAC name is 1-[[chloromethyl(phenyl)phosphoryl]methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[[chloromethyl(phenyl)phosphoryl]methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3892982 |
| Molecular Formula | C17H19ClN3O4P |
| Molecular Weight | 395.78 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-[[chloromethyl(phenyl)phosphoryl]methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CP(=O)(CCl)c2ccccc2)c1=O |
| InChI | InChI=1S/C17H19ClN3O4P/c1-3-10-19-15(22)20(11-4-2)17(24)21(16(19)23)13-26(25,12-18)14-8-6-5-7-9-14/h3-9H,1-2,10-13H2 |
| InChIKey | UAHIZHGIBAKANQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.78 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|