C18H19N2O3P — CID 694557
(6R)-6-diphenylphosphoryl-1,3-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 694557) has the molecular formula C18H19N2O3P and a molecular weight of 342.34 g/mol. Its IUPAC name is (6R)-6-diphenylphosphoryl-1,3-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | (6R)-6-diphenylphosphoryl-1,3-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 694557 |
| Molecular Formula | C18H19N2O3P |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (6R)-6-diphenylphosphoryl-1,3-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)C[C@@H](P(=O)(c2ccccc2)c2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C18H19N2O3P/c1-19-16(21)13-17(20(2)18(19)22)24(23,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,17H,13H2,1-2H3/t17-/m1/s1 |
| InChIKey | BHSXVPZFIWAEKX-QGZVFWFLSA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|