C23H33N2O2P — CID 2258280
(2R)-3-(diethylamino)-2-diphenylphosphoryl-N,N-diethylpropanamide (PubChem CID 2258280) has the molecular formula C23H33N2O2P and a molecular weight of 400.50 g/mol. Its IUPAC name is (2R)-3-(diethylamino)-2-diphenylphosphoryl-N,N-diethylpropanamide.
| Compound Name | (2R)-3-(diethylamino)-2-diphenylphosphoryl-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 2258280 |
| Molecular Formula | C23H33N2O2P |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (2R)-3-(diethylamino)-2-diphenylphosphoryl-N,N-diethylpropanamide |
| SMILES | CCN(CC)C[C@H](C(=O)N(CC)CC)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H33N2O2P/c1-5-24(6-2)19-22(23(26)25(7-3)8-4)28(27,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18,22H,5-8,19H2,1-4H3/t22-/m1/s1 |
| InChIKey | UYWFGOGKZMUZBS-JOCHJYFZSA-N |
| XLogP | 3.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|