C20H24NO2P — CID 698851
1-diphenylphosphoryl-N,N-diethylcyclopropane-1-carboxamide (PubChem CID 698851) has the molecular formula C20H24NO2P and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-diphenylphosphoryl-N,N-diethylcyclopropane-1-carboxamide.
| Compound Name | 1-diphenylphosphoryl-N,N-diethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 698851 |
| Molecular Formula | C20H24NO2P |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-diphenylphosphoryl-N,N-diethylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(P(=O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24NO2P/c1-3-21(4-2)19(22)20(15-16-20)24(23,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | VMHDOZRHLNVYEJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|