C19H24NO2P — CID 14897367
2-diphenylphosphoryl-N,N-diethylpropanamide (PubChem CID 14897367) has the molecular formula C19H24NO2P and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N,N-diethylpropanamide.
| Compound Name | 2-diphenylphosphoryl-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 14897367 |
| Molecular Formula | C19H24NO2P |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 2-diphenylphosphoryl-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24NO2P/c1-4-20(5-2)19(21)16(3)23(22,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,4-5H2,1-3H3 |
| InChIKey | BZAQEINCHHFKGF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|