C26H37N2O2P — CID 177433281
1-diphenylphosphanyl-N-hexyl-N-(hexylcarbamoyl)formamide (PubChem CID 177433281) has the molecular formula C26H37N2O2P and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-diphenylphosphanyl-N-hexyl-N-(hexylcarbamoyl)formamide.
| Compound Name | 1-diphenylphosphanyl-N-hexyl-N-(hexylcarbamoyl)formamide |
|---|---|
| PubChem CID | 177433281 |
| Molecular Formula | C26H37N2O2P |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 1-diphenylphosphanyl-N-hexyl-N-(hexylcarbamoyl)formamide |
| SMILES | CCCCCCNC(=O)N(CCCCCC)C(=O)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H37N2O2P/c1-3-5-7-15-21-27-25(29)28(22-16-8-6-4-2)26(30)31(23-17-11-9-12-18-23)24-19-13-10-14-20-24/h9-14,17-20H,3-8,15-16,21-22H2,1-2H3,(H,27,29) |
| InChIKey | LTAYPHLZGQHPOL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|