C16H19N2O2P — CID 155919950
1-diphenylphosphoryl-3-propylurea (PubChem CID 155919950) has the molecular formula C16H19N2O2P and a molecular weight of 302.31 g/mol. Its IUPAC name is 1-diphenylphosphoryl-3-propylurea.
| Compound Name | 1-diphenylphosphoryl-3-propylurea |
|---|---|
| PubChem CID | 155919950 |
| Molecular Formula | C16H19N2O2P |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-diphenylphosphoryl-3-propylurea |
| SMILES | CCCNC(=O)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19N2O2P/c1-2-13-17-16(19)18-21(20,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3,(H2,17,18,19,20) |
| InChIKey | CDLCWAFXGUIIQZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|